C14H14F2N4S — CID 62229802
3-[(2,4-difluorophenyl)methylamino]-5,6-dimethylpyridazine-4-carbothioamide (PubChem CID 62229802) has the molecular formula C14H14F2N4S and a molecular weight of 308.36 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methylamino]-5,6-dimethylpyridazine-4-carbothioamide.
| Compound Name | 3-[(2,4-difluorophenyl)methylamino]-5,6-dimethylpyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 62229802 |
| Molecular Formula | C14H14F2N4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methylamino]-5,6-dimethylpyridazine-4-carbothioamide |
| SMILES | Cc1nnc(NCc2ccc(F)cc2F)c(C(N)=S)c1C |
| InChI | InChI=1S/C14H14F2N4S/c1-7-8(2)19-20-14(12(7)13(17)21)18-6-9-3-4-10(15)5-11(9)16/h3-5H,6H2,1-2H3,(H2,17,21)(H,18,20) |
| InChIKey | BFDIVQIORFDMCU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|