C11H14F3N5S — CID 62245884
N-ethyl-2,2,2-trifluoro-N-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl]ethanamine (PubChem CID 62245884) has the molecular formula C11H14F3N5S and a molecular weight of 305.33 g/mol. Its IUPAC name is N-ethyl-2,2,2-trifluoro-N-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl]ethanamine.
| Compound Name | N-ethyl-2,2,2-trifluoro-N-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 62245884 |
| Molecular Formula | C11H14F3N5S |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | N-ethyl-2,2,2-trifluoro-N-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl]ethanamine |
| SMILES | CCN(Cc1nc(NN)c2ccsc2n1)CC(F)(F)F |
| InChI | InChI=1S/C11H14F3N5S/c1-2-19(6-11(12,13)14)5-8-16-9(18-15)7-3-4-20-10(7)17-8/h3-4H,2,5-6,15H2,1H3,(H,16,17,18) |
| InChIKey | WQAGUROONWDNJK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|