About 3-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl-(2-methoxyethyl)amino]propanenitrile
3-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl-(2-methoxyethyl)amino]propanenitrile (PubChem CID 63285734) has the molecular formula C13H18N6OS
and a molecular weight of 306.39 g/mol. Its IUPAC name is 3-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl-(2-methoxyethyl)amino]propanenitrile.
Molecular Properties
| Compound Name | 3-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl-(2-methoxyethyl)amino]propanenitrile |
| PubChem CID | 63285734 |
| Molecular Formula | C13H18N6OS |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 3-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl-(2-methoxyethyl)amino]propanenitrile |
| SMILES | COCCN(CCC#N)Cc1nc(NN)c2ccsc2n1 |
| InChI | InChI=1S/C13H18N6OS/c1-20-7-6-19(5-2-4-14)9-11-16-12(18-15)10-3-8-21-13(10)17-11/h3,8H,2,5-7,9,15H2,1H3,(H,16,17,18) |
| InChIKey | WSQOQOVQXHWOFK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl-(2-methoxyethyl)amino]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl-(2-methoxyethyl)amino]propanenitrile?
The IUPAC name of 3-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl-(2-methoxyethyl)amino]propanenitrile (CID 63285734) is 3-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl-(2-methoxyethyl)amino]propanenitrile.
What is the SMILES notation for 3-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl-(2-methoxyethyl)amino]propanenitrile?
The canonical SMILES for 3-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl-(2-methoxyethyl)amino]propanenitrile is COCCN(CCC#N)Cc1nc(NN)c2ccsc2n1.
What is the InChIKey of 3-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl-(2-methoxyethyl)amino]propanenitrile?
The InChIKey is WSQOQOVQXHWOFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N6OS/c1-20-7-6-19(5-2-4-14)9-11-16-12(18-15)10-3-8-21-13(10)17-11/h3,8H,2,5-7,9,15H2,1H3,(H,16,17,18).
What are the key properties of 3-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl-(2-methoxyethyl)amino]propanenitrile?
3-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl-(2-methoxyethyl)amino]propanenitrile has a molecular weight of 306.39 g/mol, XLogP of 1.34, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-hydrazinylthieno[2,3-d]pyrimidin-2-yl)methyl-(2-methoxyethyl)amino]propanenitrile is sourced from PubChem (CID 63285734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).