C18H11Cl2N3O2S — CID 6229473
(2Z)-2-cyano-N-(3,4-dichlorophenyl)-2-(4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)acetamide (PubChem CID 6229473) has the molecular formula C18H11Cl2N3O2S and a molecular weight of 404.28 g/mol. Its IUPAC name is (2Z)-2-cyano-N-(3,4-dichlorophenyl)-2-(4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)acetamide.
| Compound Name | (2Z)-2-cyano-N-(3,4-dichlorophenyl)-2-(4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)acetamide |
|---|---|
| PubChem CID | 6229473 |
| Molecular Formula | C18H11Cl2N3O2S |
| Molecular Weight | 404.28 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | (2Z)-2-cyano-N-(3,4-dichlorophenyl)-2-(4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)acetamide |
| SMILES | N#C/C(C(=O)Nc1ccc(Cl)c(Cl)c1)=C1/SCC(=O)N1c1ccccc1 |
| InChI | InChI=1S/C18H11Cl2N3O2S/c19-14-7-6-11(8-15(14)20)22-17(25)13(9-21)18-23(16(24)10-26-18)12-4-2-1-3-5-12/h1-8H,10H2,(H,22,25)/b18-13- |
| InChIKey | XMIWIITUEOUCQY-AQTBWJFISA-N |
| XLogP | 4.45 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.28 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|