About (1E)-1-[1-(cyanomethyl)-2-oxo-3-phenylimidazolidin-4-ylidene]-3-(3,4-dichlorophenyl)urea
(1E)-1-[1-(cyanomethyl)-2-oxo-3-phenylimidazolidin-4-ylidene]-3-(3,4-dichlorophenyl)urea (PubChem CID 134069172) has the molecular formula C18H13Cl2N5O2
and a molecular weight of 402.24 g/mol. Its IUPAC name is (1E)-1-[1-(cyanomethyl)-2-oxo-3-phenylimidazolidin-4-ylidene]-3-(3,4-dichlorophenyl)urea.
Molecular Properties
| Compound Name | (1E)-1-[1-(cyanomethyl)-2-oxo-3-phenylimidazolidin-4-ylidene]-3-(3,4-dichlorophenyl)urea |
| PubChem CID | 134069172 |
| Molecular Formula | C18H13Cl2N5O2 |
| Molecular Weight | 402.24 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | (1E)-1-[1-(cyanomethyl)-2-oxo-3-phenylimidazolidin-4-ylidene]-3-(3,4-dichlorophenyl)urea |
| SMILES | N#CCN1C/C(=N\C(=O)Nc2ccc(Cl)c(Cl)c2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H13Cl2N5O2/c19-14-7-6-12(10-15(14)20)22-17(26)23-16-11-24(9-8-21)18(27)25(16)13-4-2-1-3-5-13/h1-7,10H,9,11H2,(H,22,26)/b23-16+ |
| InChIKey | OIKYOTRUFLMINW-XQNSMLJCSA-N |
| XLogP | 4.39 |
| TPSA | 88.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.24 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-[1-(cyanomethyl)-2-oxo-3-phenylimidazolidin-4-ylidene]-3-(3,4-dichlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-[1-(cyanomethyl)-2-oxo-3-phenylimidazolidin-4-ylidene]-3-(3,4-dichlorophenyl)urea?
The IUPAC name of (1E)-1-[1-(cyanomethyl)-2-oxo-3-phenylimidazolidin-4-ylidene]-3-(3,4-dichlorophenyl)urea (CID 134069172) is (1E)-1-[1-(cyanomethyl)-2-oxo-3-phenylimidazolidin-4-ylidene]-3-(3,4-dichlorophenyl)urea.
What is the SMILES notation for (1E)-1-[1-(cyanomethyl)-2-oxo-3-phenylimidazolidin-4-ylidene]-3-(3,4-dichlorophenyl)urea?
The canonical SMILES for (1E)-1-[1-(cyanomethyl)-2-oxo-3-phenylimidazolidin-4-ylidene]-3-(3,4-dichlorophenyl)urea is N#CCN1C/C(=N\C(=O)Nc2ccc(Cl)c(Cl)c2)N(c2ccccc2)C1=O.
What is the InChIKey of (1E)-1-[1-(cyanomethyl)-2-oxo-3-phenylimidazolidin-4-ylidene]-3-(3,4-dichlorophenyl)urea?
The InChIKey is OIKYOTRUFLMINW-XQNSMLJCSA-N. The full InChI is InChI=1S/C18H13Cl2N5O2/c19-14-7-6-12(10-15(14)20)22-17(26)23-16-11-24(9-8-21)18(27)25(16)13-4-2-1-3-5-13/h1-7,10H,9,11H2,(H,22,26)/b23-16+.
What are the key properties of (1E)-1-[1-(cyanomethyl)-2-oxo-3-phenylimidazolidin-4-ylidene]-3-(3,4-dichlorophenyl)urea?
(1E)-1-[1-(cyanomethyl)-2-oxo-3-phenylimidazolidin-4-ylidene]-3-(3,4-dichlorophenyl)urea has a molecular weight of 402.24 g/mol, XLogP of 4.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-[1-(cyanomethyl)-2-oxo-3-phenylimidazolidin-4-ylidene]-3-(3,4-dichlorophenyl)urea is sourced from PubChem (CID 134069172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).