C28H24N2O2 — CID 6233444
2-[[(E)-3-naphthalen-1-ylprop-2-enoyl]amino]-N-(2-phenylethyl)benzamide (PubChem CID 6233444) has the molecular formula C28H24N2O2 and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-[[(E)-3-naphthalen-1-ylprop-2-enoyl]amino]-N-(2-phenylethyl)benzamide.
| Compound Name | 2-[[(E)-3-naphthalen-1-ylprop-2-enoyl]amino]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 6233444 |
| Molecular Formula | C28H24N2O2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 2-[[(E)-3-naphthalen-1-ylprop-2-enoyl]amino]-N-(2-phenylethyl)benzamide |
| SMILES | O=C(/C=C/c1cccc2ccccc12)Nc1ccccc1C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C28H24N2O2/c31-27(18-17-23-13-8-12-22-11-4-5-14-24(22)23)30-26-16-7-6-15-25(26)28(32)29-20-19-21-9-2-1-3-10-21/h1-18H,19-20H2,(H,29,32)(H,30,31)/b18-17+ |
| InChIKey | CXFNQCRBGKRMCY-ISLYRVAYSA-N |
| XLogP | 5.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|