C9H7Cl3O — CID 62395185
2-chloro-3-(3,5-dichlorophenyl)propanal (PubChem CID 62395185) has the molecular formula C9H7Cl3O and a molecular weight of 237.51 g/mol. Its IUPAC name is 2-chloro-3-(3,5-dichlorophenyl)propanal.
| Compound Name | 2-chloro-3-(3,5-dichlorophenyl)propanal |
|---|---|
| PubChem CID | 62395185 |
| Molecular Formula | C9H7Cl3O |
| Molecular Weight | 237.51 g/mol |
| Exact Mass | 235.96 |
| IUPAC Name | 2-chloro-3-(3,5-dichlorophenyl)propanal |
| SMILES | O=CC(Cl)Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C9H7Cl3O/c10-7-1-6(2-8(11)4-7)3-9(12)5-13/h1-2,4-5,9H,3H2 |
| InChIKey | YUHHLSPAHLBQBD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|