About methyl 2-[(2,5-dimethylthiophen-3-yl)-hydroxymethyl]butanoate
methyl 2-[(2,5-dimethylthiophen-3-yl)-hydroxymethyl]butanoate (PubChem CID 62395437) has the molecular formula C12H18O3S
and a molecular weight of 242.34 g/mol. Its IUPAC name is methyl 2-[(2,5-dimethylthiophen-3-yl)-hydroxymethyl]butanoate.
Analyze methyl 2-[(2,5-dimethylthiophen-3-yl)-hydroxymethyl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2,5-dimethylthiophen-3-yl)-hydroxymethyl]butanoate?
The IUPAC name of methyl 2-[(2,5-dimethylthiophen-3-yl)-hydroxymethyl]butanoate (CID 62395437) is methyl 2-[(2,5-dimethylthiophen-3-yl)-hydroxymethyl]butanoate.
What is the SMILES notation for methyl 2-[(2,5-dimethylthiophen-3-yl)-hydroxymethyl]butanoate?
The canonical SMILES for methyl 2-[(2,5-dimethylthiophen-3-yl)-hydroxymethyl]butanoate is CCC(C(=O)OC)C(O)c1cc(C)sc1C.
What is the InChIKey of methyl 2-[(2,5-dimethylthiophen-3-yl)-hydroxymethyl]butanoate?
The InChIKey is NZYYAFPZFMNGRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3S/c1-5-9(12(14)15-4)11(13)10-6-7(2)16-8(10)3/h6,9,11,13H,5H2,1-4H3.
What are the key properties of methyl 2-[(2,5-dimethylthiophen-3-yl)-hydroxymethyl]butanoate?
methyl 2-[(2,5-dimethylthiophen-3-yl)-hydroxymethyl]butanoate has a molecular weight of 242.34 g/mol, XLogP of 2.60, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2,5-dimethylthiophen-3-yl)-hydroxymethyl]butanoate is sourced from PubChem (CID 62395437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).