C14H10BrN3O2S — CID 62405169
4-[(5-bromothiophen-2-yl)methylamino]quinazoline-2-carboxylic acid (PubChem CID 62405169) has the molecular formula C14H10BrN3O2S and a molecular weight of 364.22 g/mol. Its IUPAC name is 4-[(5-bromothiophen-2-yl)methylamino]quinazoline-2-carboxylic acid.
| Compound Name | 4-[(5-bromothiophen-2-yl)methylamino]quinazoline-2-carboxylic acid |
|---|---|
| PubChem CID | 62405169 |
| Molecular Formula | C14H10BrN3O2S |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | 4-[(5-bromothiophen-2-yl)methylamino]quinazoline-2-carboxylic acid |
| SMILES | O=C(O)c1nc(NCc2ccc(Br)s2)c2ccccc2n1 |
| InChI | InChI=1S/C14H10BrN3O2S/c15-11-6-5-8(21-11)7-16-12-9-3-1-2-4-10(9)17-13(18-12)14(19)20/h1-6H,7H2,(H,19,20)(H,16,17,18) |
| InChIKey | TWBGAQMXWGKMFT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |