C29H23N5O5S2 — CID 6244764
N-[(Z)-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 6244764) has the molecular formula C29H23N5O5S2 and a molecular weight of 585.67 g/mol. Its IUPAC name is N-[(Z)-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(Z)-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 6244764 |
| Molecular Formula | C29H23N5O5S2 |
| Molecular Weight | 585.67 g/mol |
| Exact Mass | 585.11 |
| IUPAC Name | N-[(Z)-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-phenylpyrazol-4-yl]methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(N/N=C\c1cn(-c2ccccc2)nc1-c1ccc2c(c1)OCCO2)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C29H23N5O5S2/c35-29(23-9-4-5-10-24(23)33-41(36,37)27-11-6-16-40-27)31-30-18-21-19-34(22-7-2-1-3-8-22)32-28(21)20-12-13-25-26(17-20)39-15-14-38-25/h1-13,16-19,33H,14-15H2,(H,31,35)/b30-18- |
| InChIKey | KVFPSCVRSHQOHF-YKQZZPSBSA-N |
| XLogP | 4.94 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.67 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|