About 5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridin-3-amine
5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridin-3-amine (PubChem CID 62476249) has the molecular formula C8H9N5S
and a molecular weight of 207.26 g/mol. Its IUPAC name is 5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridin-3-amine.
Molecular Properties
| Compound Name | 5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridin-3-amine |
| PubChem CID | 62476249 |
| Molecular Formula | C8H9N5S |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridin-3-amine |
| SMILES | Cc1cc(N)cnc1Sc1ncn[nH]1 |
| InChI | InChI=1S/C8H9N5S/c1-5-2-6(9)3-10-7(5)14-8-11-4-12-13-8/h2-4H,9H2,1H3,(H,11,12,13) |
| InChIKey | HIIATIYPDFRXBC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridin-3-amine?
The IUPAC name of 5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridin-3-amine (CID 62476249) is 5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridin-3-amine.
What is the SMILES notation for 5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridin-3-amine?
The canonical SMILES for 5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridin-3-amine is Cc1cc(N)cnc1Sc1ncn[nH]1.
What is the InChIKey of 5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridin-3-amine?
The InChIKey is HIIATIYPDFRXBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5S/c1-5-2-6(9)3-10-7(5)14-8-11-4-12-13-8/h2-4H,9H2,1H3,(H,11,12,13).
What are the key properties of 5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridin-3-amine?
5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridin-3-amine has a molecular weight of 207.26 g/mol, XLogP of 1.24, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanyl)pyridin-3-amine is sourced from PubChem (CID 62476249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).