C15H22N2S — CID 62523651
N-(2,3-dimethylphenyl)-4,4-diethyl-5H-1,3-thiazol-2-amine (PubChem CID 62523651) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-4,4-diethyl-5H-1,3-thiazol-2-amine.
| Compound Name | N-(2,3-dimethylphenyl)-4,4-diethyl-5H-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62523651 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-(2,3-dimethylphenyl)-4,4-diethyl-5H-1,3-thiazol-2-amine |
| SMILES | CCC1(CC)CSC(Nc2cccc(C)c2C)=N1 |
| InChI | InChI=1S/C15H22N2S/c1-5-15(6-2)10-18-14(17-15)16-13-9-7-8-11(3)12(13)4/h7-9H,5-6,10H2,1-4H3,(H,16,17) |
| InChIKey | MBBNKBRFDWTCAQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |