C13H13N3 — CID 6255297
2-N-[(Z)-benzylideneamino]benzene-1,2-diamine (PubChem CID 6255297) has the molecular formula C13H13N3 and a molecular weight of 211.27 g/mol. Its IUPAC name is 2-N-[(Z)-benzylideneamino]benzene-1,2-diamine.
| Compound Name | 2-N-[(Z)-benzylideneamino]benzene-1,2-diamine |
|---|---|
| PubChem CID | 6255297 |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 2-N-[(Z)-benzylideneamino]benzene-1,2-diamine |
| SMILES | Nc1ccccc1N/N=C\c1ccccc1 |
| InChI | InChI=1S/C13H13N3/c14-12-8-4-5-9-13(12)16-15-10-11-6-2-1-3-7-11/h1-10,16H,14H2/b15-10- |
| InChIKey | LEECWLZJGWLVIS-GDNBJRDFSA-N |
| XLogP | 2.71 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|