C14H19NO — CID 62609345
2-(2,3-dihydroindol-1-ylmethyl)cyclopentan-1-ol (PubChem CID 62609345) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-ylmethyl)cyclopentan-1-ol.
| Compound Name | 2-(2,3-dihydroindol-1-ylmethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 62609345 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 2-(2,3-dihydroindol-1-ylmethyl)cyclopentan-1-ol |
| SMILES | OC1CCCC1CN1CCc2ccccc21 |
| InChI | InChI=1S/C14H19NO/c16-14-7-3-5-12(14)10-15-9-8-11-4-1-2-6-13(11)15/h1-2,4,6,12,14,16H,3,5,7-10H2 |
| InChIKey | HHULOAXZDCBOAK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |