C25H25N5O10 — CID 6261733
methyl 4-[4-[2-[(2Z)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-1H-pyrimidine-5-carboxylate (PubChem CID 6261733) has the molecular formula C25H25N5O10 and a molecular weight of 555.50 g/mol. Its IUPAC name is methyl 4-[4-[2-[(2Z)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl 4-[4-[2-[(2Z)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 6261733 |
| Molecular Formula | C25H25N5O10 |
| Molecular Weight | 555.50 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | methyl 4-[4-[2-[(2Z)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-1H-pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(OCC(=O)N/N=C\c3cc(OC)c(OC)cc3[N+](=O)[O-])c(OC)c2)nc(=O)[nH]c1C |
| InChI | InChI=1S/C25H25N5O10/c1-13-22(24(32)39-5)23(28-25(33)27-13)14-6-7-17(18(8-14)36-2)40-12-21(31)29-26-11-15-9-19(37-3)20(38-4)10-16(15)30(34)35/h6-11H,12H2,1-5H3,(H,29,31)(H,27,28,33)/b26-11- |
| InChIKey | NCPKDXRZBHJHKG-RAWMCFOBSA-N |
| XLogP | 2.00 |
| TPSA | 193.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.50 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|