C22H21IN4O7 — CID 5065688
ethyl 4-[4-[2-[2-[(5-iodofuran-2-yl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-1H-pyrimidine-5-carboxylate (PubChem CID 5065688) has the molecular formula C22H21IN4O7 and a molecular weight of 580.34 g/mol. Its IUPAC name is ethyl 4-[4-[2-[2-[(5-iodofuran-2-yl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[4-[2-[2-[(5-iodofuran-2-yl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 5065688 |
| Molecular Formula | C22H21IN4O7 |
| Molecular Weight | 580.34 g/mol |
| Exact Mass | 580.05 |
| IUPAC Name | ethyl 4-[4-[2-[2-[(5-iodofuran-2-yl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OCC(=O)NN=Cc3ccc(I)o3)c(OC)c2)nc(=O)[nH]c1C |
| InChI | InChI=1S/C22H21IN4O7/c1-4-32-21(29)19-12(2)25-22(30)26-20(19)13-5-7-15(16(9-13)31-3)33-11-18(28)27-24-10-14-6-8-17(23)34-14/h5-10H,4,11H2,1-3H3,(H,27,28)(H,25,26,30) |
| InChIKey | MHRVRHSHSLWTSB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 145.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|