About 3-N-[(5-bromothiophen-3-yl)methyl]-3-N-methyl-1,1-dioxothiolane-3,4-diamine
3-N-[(5-bromothiophen-3-yl)methyl]-3-N-methyl-1,1-dioxothiolane-3,4-diamine (PubChem CID 62693689) has the molecular formula C10H15BrN2O2S2
and a molecular weight of 339.28 g/mol. Its IUPAC name is 3-N-[(5-bromothiophen-3-yl)methyl]-3-N-methyl-1,1-dioxothiolane-3,4-diamine.
Molecular Properties
| Compound Name | 3-N-[(5-bromothiophen-3-yl)methyl]-3-N-methyl-1,1-dioxothiolane-3,4-diamine |
| PubChem CID | 62693689 |
| Molecular Formula | C10H15BrN2O2S2 |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 3-N-[(5-bromothiophen-3-yl)methyl]-3-N-methyl-1,1-dioxothiolane-3,4-diamine |
| SMILES | CN(Cc1csc(Br)c1)C1CS(=O)(=O)CC1N |
| InChI | InChI=1S/C10H15BrN2O2S2/c1-13(3-7-2-10(11)16-4-7)9-6-17(14,15)5-8(9)12/h2,4,8-9H,3,5-6,12H2,1H3 |
| InChIKey | BFRISJRDQZVNLQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-N-[(5-bromothiophen-3-yl)methyl]-3-N-methyl-1,1-dioxothiolane-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-[(5-bromothiophen-3-yl)methyl]-3-N-methyl-1,1-dioxothiolane-3,4-diamine?
The IUPAC name of 3-N-[(5-bromothiophen-3-yl)methyl]-3-N-methyl-1,1-dioxothiolane-3,4-diamine (CID 62693689) is 3-N-[(5-bromothiophen-3-yl)methyl]-3-N-methyl-1,1-dioxothiolane-3,4-diamine.
What is the SMILES notation for 3-N-[(5-bromothiophen-3-yl)methyl]-3-N-methyl-1,1-dioxothiolane-3,4-diamine?
The canonical SMILES for 3-N-[(5-bromothiophen-3-yl)methyl]-3-N-methyl-1,1-dioxothiolane-3,4-diamine is CN(Cc1csc(Br)c1)C1CS(=O)(=O)CC1N.
What is the InChIKey of 3-N-[(5-bromothiophen-3-yl)methyl]-3-N-methyl-1,1-dioxothiolane-3,4-diamine?
The InChIKey is BFRISJRDQZVNLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15BrN2O2S2/c1-13(3-7-2-10(11)16-4-7)9-6-17(14,15)5-8(9)12/h2,4,8-9H,3,5-6,12H2,1H3.
What are the key properties of 3-N-[(5-bromothiophen-3-yl)methyl]-3-N-methyl-1,1-dioxothiolane-3,4-diamine?
3-N-[(5-bromothiophen-3-yl)methyl]-3-N-methyl-1,1-dioxothiolane-3,4-diamine has a molecular weight of 339.28 g/mol, XLogP of 1.07, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-[(5-bromothiophen-3-yl)methyl]-3-N-methyl-1,1-dioxothiolane-3,4-diamine is sourced from PubChem (CID 62693689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).