C12H10F2N4O — CID 62763594
2,4-difluoro-5-(pyrazin-2-ylmethylamino)benzamide (PubChem CID 62763594) has the molecular formula C12H10F2N4O and a molecular weight of 264.24 g/mol. Its IUPAC name is 2,4-difluoro-5-(pyrazin-2-ylmethylamino)benzamide.
| Compound Name | 2,4-difluoro-5-(pyrazin-2-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 62763594 |
| Molecular Formula | C12H10F2N4O |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 2,4-difluoro-5-(pyrazin-2-ylmethylamino)benzamide |
| SMILES | NC(=O)c1cc(NCc2cnccn2)c(F)cc1F |
| InChI | InChI=1S/C12H10F2N4O/c13-9-4-10(14)11(3-8(9)12(15)19)18-6-7-5-16-1-2-17-7/h1-5,18H,6H2,(H2,15,19) |
| InChIKey | AMOZTAIVNWXGRX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |