C17H14N2O2 — CID 6281337
[(E)-[(4Z)-4-[cyano(phenyl)methylidene]-2-methylcyclohexa-2,5-dien-1-ylidene]amino] acetate (PubChem CID 6281337) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is [(E)-[(4Z)-4-[cyano(phenyl)methylidene]-2-methylcyclohexa-2,5-dien-1-ylidene]amino] acetate.
| Compound Name | [(E)-[(4Z)-4-[cyano(phenyl)methylidene]-2-methylcyclohexa-2,5-dien-1-ylidene]amino] acetate |
|---|---|
| PubChem CID | 6281337 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | [(E)-[(4Z)-4-[cyano(phenyl)methylidene]-2-methylcyclohexa-2,5-dien-1-ylidene]amino] acetate |
| SMILES | CC(=O)O/N=C1\C=C/C(=C(/C#N)c2ccccc2)C=C1C |
| InChI | InChI=1S/C17H14N2O2/c1-12-10-15(8-9-17(12)19-21-13(2)20)16(11-18)14-6-4-3-5-7-14/h3-10H,1-2H3/b16-15+,19-17+ |
| InChIKey | WBEDYKIWVKYCBI-FNIFWQFPSA-N |
| XLogP | 3.40 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_quin_methide(10)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|