C27H25N5OS — CID 6286899
2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino]acetamide (PubChem CID 6286899) has the molecular formula C27H25N5OS and a molecular weight of 467.60 g/mol. Its IUPAC name is 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino]acetamide.
| Compound Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino]acetamide |
|---|---|
| PubChem CID | 6286899 |
| Molecular Formula | C27H25N5OS |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(Z)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccccc2)n1-c1ccccc1)N/N=C1/CCCCc2ccccc21 |
| InChI | InChI=1S/C27H25N5OS/c33-25(29-28-24-18-10-8-12-20-11-7-9-17-23(20)24)19-34-27-31-30-26(21-13-3-1-4-14-21)32(27)22-15-5-2-6-16-22/h1-7,9,11,13-17H,8,10,12,18-19H2,(H,29,33)/b28-24- |
| InChIKey | OGOMOPBMDJCJDB-COOPMVRXSA-N |
| XLogP | 5.27 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|