C8H8N4O2 — CID 62903283
4-amino-N-(1,2-oxazol-3-yl)-1H-pyrrole-2-carboxamide (PubChem CID 62903283) has the molecular formula C8H8N4O2 and a molecular weight of 192.18 g/mol. Its IUPAC name is 4-amino-N-(1,2-oxazol-3-yl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-amino-N-(1,2-oxazol-3-yl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 62903283 |
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 4-amino-N-(1,2-oxazol-3-yl)-1H-pyrrole-2-carboxamide |
| SMILES | Nc1c[nH]c(C(=O)Nc2ccon2)c1 |
| InChI | InChI=1S/C8H8N4O2/c9-5-3-6(10-4-5)8(13)11-7-1-2-14-12-7/h1-4,10H,9H2,(H,11,12,13) |
| InChIKey | ONNULCLABWDNOM-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |