C8H10N6S — CID 62950186
1-(1-ethylimidazol-2-yl)-1,2,4-triazole-3-carbothioamide (PubChem CID 62950186) has the molecular formula C8H10N6S and a molecular weight of 222.28 g/mol. Its IUPAC name is 1-(1-ethylimidazol-2-yl)-1,2,4-triazole-3-carbothioamide.
| Compound Name | 1-(1-ethylimidazol-2-yl)-1,2,4-triazole-3-carbothioamide |
|---|---|
| PubChem CID | 62950186 |
| Molecular Formula | C8H10N6S |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 1-(1-ethylimidazol-2-yl)-1,2,4-triazole-3-carbothioamide |
| SMILES | CCn1ccnc1-n1cnc(C(N)=S)n1 |
| InChI | InChI=1S/C8H10N6S/c1-2-13-4-3-10-8(13)14-5-11-7(12-14)6(9)15/h3-5H,2H2,1H3,(H2,9,15) |
| InChIKey | GQZQCQSNZCFHGK-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|