C13H14FN5 — CID 62950682
1-[4-fluoro-2-(propylaminomethyl)phenyl]-1,2,4-triazole-3-carbonitrile (PubChem CID 62950682) has the molecular formula C13H14FN5 and a molecular weight of 259.29 g/mol. Its IUPAC name is 1-[4-fluoro-2-(propylaminomethyl)phenyl]-1,2,4-triazole-3-carbonitrile.
| Compound Name | 1-[4-fluoro-2-(propylaminomethyl)phenyl]-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 62950682 |
| Molecular Formula | C13H14FN5 |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-[4-fluoro-2-(propylaminomethyl)phenyl]-1,2,4-triazole-3-carbonitrile |
| SMILES | CCCNCc1cc(F)ccc1-n1cnc(C#N)n1 |
| InChI | InChI=1S/C13H14FN5/c1-2-5-16-8-10-6-11(14)3-4-12(10)19-9-17-13(7-15)18-19/h3-4,6,9,16H,2,5,8H2,1H3 |
| InChIKey | VKAHRLRACONWBE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|