4-(5-oxo-1,4-diazepan-1-yl)butanoic acid

C9H16N2O3 — CID 63004132

IUPAC4-(5-oxo-1,4-diazepan-1-yl)butanoic acid
SMILESO=C(O)CCCN1CCNC(=O)CC1
InChIInChI=1S/C9H16N2O3/c12-8-3-6-11(7-4-10-8)5-1-2-9(13)14/h1-7H2,(H,10,12)(H,13,14)
InChIKeyJLKZMYYHYKLVDZ-UHFFFAOYSA-N
MW200.24 g/mol
LogP-0.33
Rot. Bonds4

About 4-(5-oxo-1,4-diazepan-1-yl)butanoic acid

4-(5-oxo-1,4-diazepan-1-yl)butanoic acid (PubChem CID 63004132) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 4-(5-oxo-1,4-diazepan-1-yl)butanoic acid.

Molecular Properties

Compound Name4-(5-oxo-1,4-diazepan-1-yl)butanoic acid
PubChem CID63004132
Molecular FormulaC9H16N2O3
Molecular Weight200.24 g/mol
Exact Mass200.12
IUPAC Name4-(5-oxo-1,4-diazepan-1-yl)butanoic acid
SMILESO=C(O)CCCN1CCNC(=O)CC1
InChIInChI=1S/C9H16N2O3/c12-8-3-6-11(7-4-10-8)5-1-2-9(13)14/h1-7H2,(H,10,12)(H,13,14)
InChIKeyJLKZMYYHYKLVDZ-UHFFFAOYSA-N
XLogP-0.33
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.24
LogP ≤ 5-0.33
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(5-oxo-1,4-diazepan-1-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(5-oxo-1,4-diazepan-1-yl)butanoic acid?
The IUPAC name of 4-(5-oxo-1,4-diazepan-1-yl)butanoic acid (CID 63004132) is 4-(5-oxo-1,4-diazepan-1-yl)butanoic acid.
What is the SMILES notation for 4-(5-oxo-1,4-diazepan-1-yl)butanoic acid?
The canonical SMILES for 4-(5-oxo-1,4-diazepan-1-yl)butanoic acid is O=C(O)CCCN1CCNC(=O)CC1.
What is the InChIKey of 4-(5-oxo-1,4-diazepan-1-yl)butanoic acid?
The InChIKey is JLKZMYYHYKLVDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O3/c12-8-3-6-11(7-4-10-8)5-1-2-9(13)14/h1-7H2,(H,10,12)(H,13,14).
What are the key properties of 4-(5-oxo-1,4-diazepan-1-yl)butanoic acid?
4-(5-oxo-1,4-diazepan-1-yl)butanoic acid has a molecular weight of 200.24 g/mol, XLogP of -0.33, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-oxo-1,4-diazepan-1-yl)butanoic acid is sourced from PubChem (CID 63004132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).