C14H15N3O — CID 63086017
N-[1-(furan-2-yl)propan-2-yl]-1H-indazol-4-amine (PubChem CID 63086017) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is N-[1-(furan-2-yl)propan-2-yl]-1H-indazol-4-amine.
| Compound Name | N-[1-(furan-2-yl)propan-2-yl]-1H-indazol-4-amine |
|---|---|
| PubChem CID | 63086017 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | N-[1-(furan-2-yl)propan-2-yl]-1H-indazol-4-amine |
| SMILES | CC(Cc1ccco1)Nc1cccc2[nH]ncc12 |
| InChI | InChI=1S/C14H15N3O/c1-10(8-11-4-3-7-18-11)16-13-5-2-6-14-12(13)9-15-17-14/h2-7,9-10,16H,8H2,1H3,(H,15,17) |
| InChIKey | WLMUNIPZYCDKIN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |