C9H8ClN5S — CID 63092185
4-chloro-2-(1H-1,2,4-triazol-5-ylsulfanyl)benzenecarboximidamide (PubChem CID 63092185) has the molecular formula C9H8ClN5S and a molecular weight of 253.72 g/mol. Its IUPAC name is 4-chloro-2-(1H-1,2,4-triazol-5-ylsulfanyl)benzenecarboximidamide.
| Compound Name | 4-chloro-2-(1H-1,2,4-triazol-5-ylsulfanyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 63092185 |
| Molecular Formula | C9H8ClN5S |
| Molecular Weight | 253.72 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 4-chloro-2-(1H-1,2,4-triazol-5-ylsulfanyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Cl)cc1Sc1ncn[nH]1 |
| InChI | InChI=1S/C9H8ClN5S/c10-5-1-2-6(8(11)12)7(3-5)16-9-13-4-14-15-9/h1-4H,(H3,11,12)(H,13,14,15) |
| InChIKey | MXZAWLMHYNGJTJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.72 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|