C17H14INO2 — CID 63096091
6-(2-iodobenzoyl)-1-methyl-3,4-dihydroquinolin-2-one (PubChem CID 63096091) has the molecular formula C17H14INO2 and a molecular weight of 391.21 g/mol. Its IUPAC name is 6-(2-iodobenzoyl)-1-methyl-3,4-dihydroquinolin-2-one.
| Compound Name | 6-(2-iodobenzoyl)-1-methyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 63096091 |
| Molecular Formula | C17H14INO2 |
| Molecular Weight | 391.21 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | 6-(2-iodobenzoyl)-1-methyl-3,4-dihydroquinolin-2-one |
| SMILES | CN1C(=O)CCc2cc(C(=O)c3ccccc3I)ccc21 |
| InChI | InChI=1S/C17H14INO2/c1-19-15-8-6-12(10-11(15)7-9-16(19)20)17(21)13-4-2-3-5-14(13)18/h2-6,8,10H,7,9H2,1H3 |
| InChIKey | JGYPKJVOQYIPSX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.21 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|