C10H10Br2N4 — CID 63111769
2,4-dibromo-6-(2,5-dimethyl-1,2,4-triazol-3-yl)aniline (PubChem CID 63111769) has the molecular formula C10H10Br2N4 and a molecular weight of 346.03 g/mol. Its IUPAC name is 2,4-dibromo-6-(2,5-dimethyl-1,2,4-triazol-3-yl)aniline.
| Compound Name | 2,4-dibromo-6-(2,5-dimethyl-1,2,4-triazol-3-yl)aniline |
|---|---|
| PubChem CID | 63111769 |
| Molecular Formula | C10H10Br2N4 |
| Molecular Weight | 346.03 g/mol |
| Exact Mass | 343.93 |
| IUPAC Name | 2,4-dibromo-6-(2,5-dimethyl-1,2,4-triazol-3-yl)aniline |
| SMILES | Cc1nc(-c2cc(Br)cc(Br)c2N)n(C)n1 |
| InChI | InChI=1S/C10H10Br2N4/c1-5-14-10(16(2)15-5)7-3-6(11)4-8(12)9(7)13/h3-4H,13H2,1-2H3 |
| InChIKey | QJMAWIFTIUKZJO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.03 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|