C11H22N2S — CID 63160841
2-(4,4-diethylpiperidin-1-yl)ethanethioamide (PubChem CID 63160841) has the molecular formula C11H22N2S and a molecular weight of 214.38 g/mol. Its IUPAC name is 2-(4,4-diethylpiperidin-1-yl)ethanethioamide.
| Compound Name | 2-(4,4-diethylpiperidin-1-yl)ethanethioamide |
|---|---|
| PubChem CID | 63160841 |
| Molecular Formula | C11H22N2S |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 2-(4,4-diethylpiperidin-1-yl)ethanethioamide |
| SMILES | CCC1(CC)CCN(CC(N)=S)CC1 |
| InChI | InChI=1S/C11H22N2S/c1-3-11(4-2)5-7-13(8-6-11)9-10(12)14/h3-9H2,1-2H3,(H2,12,14) |
| InChIKey | CQKHTIPVJJOKKR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|