C11H22N2O — CID 63182094
2,2-dimethyl-1-(2-methyl-1,4-oxazepan-4-yl)propan-1-imine (PubChem CID 63182094) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 2,2-dimethyl-1-(2-methyl-1,4-oxazepan-4-yl)propan-1-imine.
| Compound Name | 2,2-dimethyl-1-(2-methyl-1,4-oxazepan-4-yl)propan-1-imine |
|---|---|
| PubChem CID | 63182094 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 2,2-dimethyl-1-(2-methyl-1,4-oxazepan-4-yl)propan-1-imine |
| SMILES | [H]/N=C(\N1CCCOC(C)C1)C(C)(C)C |
| InChI | InChI=1S/C11H22N2O/c1-9-8-13(6-5-7-14-9)10(12)11(2,3)4/h9,12H,5-8H2,1-4H3/b12-10- |
| InChIKey | DBKJYKGAJBZZQD-BENRWUELSA-N |
| XLogP | 2.12 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|