C11H22N2O — CID 104961271
1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2,2-dimethylpropan-1-imine (PubChem CID 104961271) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2,2-dimethylpropan-1-imine.
| Compound Name | 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2,2-dimethylpropan-1-imine |
|---|---|
| PubChem CID | 104961271 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2,2-dimethylpropan-1-imine |
| SMILES | [H]/N=C(\N1C[C@@H](C)O[C@@H](C)C1)C(C)(C)C |
| InChI | InChI=1S/C11H22N2O/c1-8-6-13(7-9(2)14-8)10(12)11(3,4)5/h8-9,12H,6-7H2,1-5H3/b12-10-/t8-,9+ |
| InChIKey | JJGHOKKDZBCRTQ-DDEVNKPQSA-N |
| XLogP | 2.12 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|