C7H13F3O3S — CID 63192213
1,1,1-trifluoro-6-methylsulfonylhexan-3-ol (PubChem CID 63192213) has the molecular formula C7H13F3O3S and a molecular weight of 234.24 g/mol. Its IUPAC name is 1,1,1-trifluoro-6-methylsulfonylhexan-3-ol.
| Compound Name | 1,1,1-trifluoro-6-methylsulfonylhexan-3-ol |
|---|---|
| PubChem CID | 63192213 |
| Molecular Formula | C7H13F3O3S |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 1,1,1-trifluoro-6-methylsulfonylhexan-3-ol |
| SMILES | CS(=O)(=O)CCCC(O)CC(F)(F)F |
| InChI | InChI=1S/C7H13F3O3S/c1-14(12,13)4-2-3-6(11)5-7(8,9)10/h6,11H,2-5H2,1H3 |
| InChIKey | WHDZXTIMLVRDGD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |