C12H12N2O3S — CID 63198946
3-methyl-1-(4-nitro-1,3-benzothiazol-5-yl)butan-2-one (PubChem CID 63198946) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 3-methyl-1-(4-nitro-1,3-benzothiazol-5-yl)butan-2-one.
| Compound Name | 3-methyl-1-(4-nitro-1,3-benzothiazol-5-yl)butan-2-one |
|---|---|
| PubChem CID | 63198946 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 3-methyl-1-(4-nitro-1,3-benzothiazol-5-yl)butan-2-one |
| SMILES | CC(C)C(=O)Cc1ccc2scnc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12N2O3S/c1-7(2)9(15)5-8-3-4-10-11(13-6-18-10)12(8)14(16)17/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | RWHRYQKIQGBMOX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|