C14H19N3O2S — CID 63199802
3-(4-nitro-1,3-benzothiazol-5-yl)-N-propylbutan-2-amine (PubChem CID 63199802) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is 3-(4-nitro-1,3-benzothiazol-5-yl)-N-propylbutan-2-amine.
| Compound Name | 3-(4-nitro-1,3-benzothiazol-5-yl)-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 63199802 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 3-(4-nitro-1,3-benzothiazol-5-yl)-N-propylbutan-2-amine |
| SMILES | CCCNC(C)C(C)c1ccc2scnc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19N3O2S/c1-4-7-15-10(3)9(2)11-5-6-12-13(16-8-20-12)14(11)17(18)19/h5-6,8-10,15H,4,7H2,1-3H3 |
| InChIKey | DWZLUNXABISPAK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|