C11H12N2O3S2 — CID 66105966
2-methyl-3-[(4-nitro-1,3-benzothiazol-5-yl)sulfanyl]propan-1-ol (PubChem CID 66105966) has the molecular formula C11H12N2O3S2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-methyl-3-[(4-nitro-1,3-benzothiazol-5-yl)sulfanyl]propan-1-ol.
| Compound Name | 2-methyl-3-[(4-nitro-1,3-benzothiazol-5-yl)sulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 66105966 |
| Molecular Formula | C11H12N2O3S2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 2-methyl-3-[(4-nitro-1,3-benzothiazol-5-yl)sulfanyl]propan-1-ol |
| SMILES | CC(CO)CSc1ccc2scnc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12N2O3S2/c1-7(4-14)5-17-9-3-2-8-10(12-6-18-8)11(9)13(15)16/h2-3,6-7,14H,4-5H2,1H3 |
| InChIKey | MAOJNDDEVPCXOK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|