About 2-methyl-3-[(4-nitro-1,3-benzothiazol-5-yl)sulfanyl]propan-1-ol
2-methyl-3-[(4-nitro-1,3-benzothiazol-5-yl)sulfanyl]propan-1-ol (PubChem CID 66105966) has the molecular formula C11H12N2O3S2
and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-methyl-3-[(4-nitro-1,3-benzothiazol-5-yl)sulfanyl]propan-1-ol.
Molecular Properties
| Compound Name | 2-methyl-3-[(4-nitro-1,3-benzothiazol-5-yl)sulfanyl]propan-1-ol |
| PubChem CID | 66105966 |
| Molecular Formula | C11H12N2O3S2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 2-methyl-3-[(4-nitro-1,3-benzothiazol-5-yl)sulfanyl]propan-1-ol |
| SMILES | CC(CO)CSc1ccc2scnc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12N2O3S2/c1-7(4-14)5-17-9-3-2-8-10(12-6-18-8)11(9)13(15)16/h2-3,6-7,14H,4-5H2,1H3 |
| InChIKey | MAOJNDDEVPCXOK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-[(4-nitro-1,3-benzothiazol-5-yl)sulfanyl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-[(4-nitro-1,3-benzothiazol-5-yl)sulfanyl]propan-1-ol?
The IUPAC name of 2-methyl-3-[(4-nitro-1,3-benzothiazol-5-yl)sulfanyl]propan-1-ol (CID 66105966) is 2-methyl-3-[(4-nitro-1,3-benzothiazol-5-yl)sulfanyl]propan-1-ol.
What is the SMILES notation for 2-methyl-3-[(4-nitro-1,3-benzothiazol-5-yl)sulfanyl]propan-1-ol?
The canonical SMILES for 2-methyl-3-[(4-nitro-1,3-benzothiazol-5-yl)sulfanyl]propan-1-ol is CC(CO)CSc1ccc2scnc2c1[N+](=O)[O-].
What is the InChIKey of 2-methyl-3-[(4-nitro-1,3-benzothiazol-5-yl)sulfanyl]propan-1-ol?
The InChIKey is MAOJNDDEVPCXOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3S2/c1-7(4-14)5-17-9-3-2-8-10(12-6-18-8)11(9)13(15)16/h2-3,6-7,14H,4-5H2,1H3.
What are the key properties of 2-methyl-3-[(4-nitro-1,3-benzothiazol-5-yl)sulfanyl]propan-1-ol?
2-methyl-3-[(4-nitro-1,3-benzothiazol-5-yl)sulfanyl]propan-1-ol has a molecular weight of 284.36 g/mol, XLogP of 2.92, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-[(4-nitro-1,3-benzothiazol-5-yl)sulfanyl]propan-1-ol is sourced from PubChem (CID 66105966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).