C12H16N2O2S — CID 63199597
3-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-methylbutan-2-amine (PubChem CID 63199597) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 3-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-methylbutan-2-amine.
| Compound Name | 3-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 63199597 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 3-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-methylbutan-2-amine |
| SMILES | CNC(C)C(C)C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C12H16N2O2S/c1-8(9(2)13-3)12-10-6-4-5-7-11(10)17(15,16)14-12/h4-9,13H,1-3H3 |
| InChIKey | ZIKAUUHAUAQFKW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |