C11H15ClFN — CID 63203074
2-(2-chloro-3,3-dimethylbutyl)-5-fluoropyridine (PubChem CID 63203074) has the molecular formula C11H15ClFN and a molecular weight of 215.70 g/mol. Its IUPAC name is 2-(2-chloro-3,3-dimethylbutyl)-5-fluoropyridine.
| Compound Name | 2-(2-chloro-3,3-dimethylbutyl)-5-fluoropyridine |
|---|---|
| PubChem CID | 63203074 |
| Molecular Formula | C11H15ClFN |
| Molecular Weight | 215.70 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 2-(2-chloro-3,3-dimethylbutyl)-5-fluoropyridine |
| SMILES | CC(C)(C)C(Cl)Cc1ccc(F)cn1 |
| InChI | InChI=1S/C11H15ClFN/c1-11(2,3)10(12)6-9-5-4-8(13)7-14-9/h4-5,7,10H,6H2,1-3H3 |
| InChIKey | UOVPKGHNJWVZLW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.70 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|