About [6-(2,2-dimethylpyrrolidin-1-yl)-2-pyridinyl]methanol
[6-(2,2-dimethylpyrrolidin-1-yl)-2-pyridinyl]methanol (PubChem CID 63217278) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is [6-(2,2-dimethylpyrrolidin-1-yl)-2-pyridinyl]methanol.
Molecular Properties
| Compound Name | [6-(2,2-dimethylpyrrolidin-1-yl)-2-pyridinyl]methanol |
| PubChem CID | 63217278 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | [6-(2,2-dimethylpyrrolidin-1-yl)-2-pyridinyl]methanol |
| SMILES | CC1(C)CCCN1c1cccc(CO)n1 |
| InChI | InChI=1S/C12H18N2O/c1-12(2)7-4-8-14(12)11-6-3-5-10(9-15)13-11/h3,5-6,15H,4,7-9H2,1-2H3 |
| InChIKey | SNOXJIYMTTXXKD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [6-(2,2-dimethylpyrrolidin-1-yl)-2-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(2,2-dimethylpyrrolidin-1-yl)-2-pyridinyl]methanol?
The IUPAC name of [6-(2,2-dimethylpyrrolidin-1-yl)-2-pyridinyl]methanol (CID 63217278) is [6-(2,2-dimethylpyrrolidin-1-yl)-2-pyridinyl]methanol.
What is the SMILES notation for [6-(2,2-dimethylpyrrolidin-1-yl)-2-pyridinyl]methanol?
The canonical SMILES for [6-(2,2-dimethylpyrrolidin-1-yl)-2-pyridinyl]methanol is CC1(C)CCCN1c1cccc(CO)n1.
What is the InChIKey of [6-(2,2-dimethylpyrrolidin-1-yl)-2-pyridinyl]methanol?
The InChIKey is SNOXJIYMTTXXKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O/c1-12(2)7-4-8-14(12)11-6-3-5-10(9-15)13-11/h3,5-6,15H,4,7-9H2,1-2H3.
What are the key properties of [6-(2,2-dimethylpyrrolidin-1-yl)-2-pyridinyl]methanol?
[6-(2,2-dimethylpyrrolidin-1-yl)-2-pyridinyl]methanol has a molecular weight of 206.29 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(2,2-dimethylpyrrolidin-1-yl)-2-pyridinyl]methanol is sourced from PubChem (CID 63217278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).