C11H17N3 — CID 80653179
6-(2,2-dimethylpyrrolidin-1-yl)pyridin-2-amine (PubChem CID 80653179) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 6-(2,2-dimethylpyrrolidin-1-yl)pyridin-2-amine.
| Compound Name | 6-(2,2-dimethylpyrrolidin-1-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 80653179 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 6-(2,2-dimethylpyrrolidin-1-yl)pyridin-2-amine |
| SMILES | CC1(C)CCCN1c1cccc(N)n1 |
| InChI | InChI=1S/C11H17N3/c1-11(2)7-4-8-14(11)10-6-3-5-9(12)13-10/h3,5-6H,4,7-8H2,1-2H3,(H2,12,13) |
| InChIKey | PAVPQFSOUYAHQN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |