C10H17N5 — CID 80914484
[6-(2,2-dimethylpyrrolidin-1-yl)pyrazin-2-yl]hydrazine (PubChem CID 80914484) has the molecular formula C10H17N5 and a molecular weight of 207.28 g/mol. Its IUPAC name is [6-(2,2-dimethylpyrrolidin-1-yl)pyrazin-2-yl]hydrazine.
| Compound Name | [6-(2,2-dimethylpyrrolidin-1-yl)pyrazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80914484 |
| Molecular Formula | C10H17N5 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | [6-(2,2-dimethylpyrrolidin-1-yl)pyrazin-2-yl]hydrazine |
| SMILES | CC1(C)CCCN1c1cncc(NN)n1 |
| InChI | InChI=1S/C10H17N5/c1-10(2)4-3-5-15(10)9-7-12-6-8(13-9)14-11/h6-7H,3-5,11H2,1-2H3,(H,13,14) |
| InChIKey | SAIYNFNDAVCFTM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|