C13H20N8 — CID 63221848
3-[ethyl-[(4-hydrazinyl-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methyl]amino]-2-methylpropanenitrile (PubChem CID 63221848) has the molecular formula C13H20N8 and a molecular weight of 288.36 g/mol. Its IUPAC name is 3-[ethyl-[(4-hydrazinyl-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methyl]amino]-2-methylpropanenitrile.
| Compound Name | 3-[ethyl-[(4-hydrazinyl-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methyl]amino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 63221848 |
| Molecular Formula | C13H20N8 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 3-[ethyl-[(4-hydrazinyl-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methyl]amino]-2-methylpropanenitrile |
| SMILES | CCN(Cc1nc(NN)c2cnn(C)c2n1)CC(C)C#N |
| InChI | InChI=1S/C13H20N8/c1-4-21(7-9(2)5-14)8-11-17-12(19-15)10-6-16-20(3)13(10)18-11/h6,9H,4,7-8,15H2,1-3H3,(H,17,18,19) |
| InChIKey | FUPKJYNDSQWNOE-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 108.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|