C29H25N5O2 — CID 6324440
4-phenyl-2-N,5-N-bis[(Z)-1-phenylethylideneamino]pyridine-2,5-dicarboxamide (PubChem CID 6324440) has the molecular formula C29H25N5O2 and a molecular weight of 475.55 g/mol. Its IUPAC name is 4-phenyl-2-N,5-N-bis[(Z)-1-phenylethylideneamino]pyridine-2,5-dicarboxamide.
| Compound Name | 4-phenyl-2-N,5-N-bis[(Z)-1-phenylethylideneamino]pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 6324440 |
| Molecular Formula | C29H25N5O2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 4-phenyl-2-N,5-N-bis[(Z)-1-phenylethylideneamino]pyridine-2,5-dicarboxamide |
| SMILES | C/C(=N/NC(=O)c1cc(-c2ccccc2)c(C(=O)N/N=C(/C)c2ccccc2)cn1)c1ccccc1 |
| InChI | InChI=1S/C29H25N5O2/c1-20(22-12-6-3-7-13-22)31-33-28(35)26-19-30-27(18-25(26)24-16-10-5-11-17-24)29(36)34-32-21(2)23-14-8-4-9-15-23/h3-19H,1-2H3,(H,33,35)(H,34,36)/b31-20-,32-21- |
| InChIKey | QHYOQWWXHZBDMW-ZWWBNGGYSA-N |
| XLogP | 5.06 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|