C15H13N3O4 — CID 6326517
N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-6-(hydroxymethyl)pyridine-3-carboxamide (PubChem CID 6326517) has the molecular formula C15H13N3O4 and a molecular weight of 299.29 g/mol. Its IUPAC name is N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-6-(hydroxymethyl)pyridine-3-carboxamide.
| Compound Name | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-6-(hydroxymethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6326517 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-6-(hydroxymethyl)pyridine-3-carboxamide |
| SMILES | O=C(N/N=C\c1ccc2c(c1)OCO2)c1ccc(CO)nc1 |
| InChI | InChI=1S/C15H13N3O4/c19-8-12-3-2-11(7-16-12)15(20)18-17-6-10-1-4-13-14(5-10)22-9-21-13/h1-7,19H,8-9H2,(H,18,20)/b17-6- |
| InChIKey | GKKJIONLHMPVHW-FMQZQXMHSA-N |
| XLogP | 1.07 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|