C22H18N3O4+ — CID 3104433
N-(1,3-benzodioxol-5-ylmethylideneamino)-1-phenacylpyridin-1-ium-4-carboxamide (PubChem CID 3104433) has the molecular formula C22H18N3O4+ and a molecular weight of 388.40 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethylideneamino)-1-phenacylpyridin-1-ium-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethylideneamino)-1-phenacylpyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 3104433 |
| Molecular Formula | C22H18N3O4+ |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethylideneamino)-1-phenacylpyridin-1-ium-4-carboxamide |
| SMILES | O=C(C[n+]1ccc(C(=O)NN=Cc2ccc3c(c2)OCO3)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H17N3O4/c26-19(17-4-2-1-3-5-17)14-25-10-8-18(9-11-25)22(27)24-23-13-16-6-7-20-21(12-16)29-15-28-20/h1-13H,14-15H2/p+1 |
| InChIKey | ADKCBZRZCATBKF-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|