C22H20N2NaO11S3 — CID 6331497
CID 6331497 (PubChem CID 6331497) has the molecular formula C22H20N2NaO11S3 and a molecular weight of 607.60 g/mol.
| Compound Name | CID 6331497 |
|---|---|
| PubChem CID | 6331497 |
| Molecular Formula | C22H20N2NaO11S3 |
| Molecular Weight | 607.60 g/mol |
| Exact Mass | 607.01 |
| IUPAC Name | — |
| SMILES | COc1ccc(OC)c2c(Nc3ccc(S(=O)(=O)O)c4cc(S(=O)(=O)O)cc(S(=O)(=O)O)c34)cc(C)nc12.[Na] |
| InChI | InChI=1S/C22H20N2O11S3.Na/c1-11-8-15(21-16(34-2)5-6-17(35-3)22(21)23-11)24-14-4-7-18(37(28,29)30)13-9-12(36(25,26)27)10-19(20(13)14)38(31,32)33;/h4-10H,1-3H3,(H,23,24)(H,25,26,27)(H,28,29,30)(H,31,32,33); |
| InChIKey | HKVOJGOOUJYQHS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 206.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.60 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|