About imino-[(Z)-3-oxo-1,3-diphenylprop-1-en-2-yl]iminoazanium
imino-[(Z)-3-oxo-1,3-diphenylprop-1-en-2-yl]iminoazanium (PubChem CID 6333032) has the molecular formula C15H12N3O+
and a molecular weight of 250.28 g/mol. Its IUPAC name is imino-[(Z)-3-oxo-1,3-diphenylprop-1-en-2-yl]iminoazanium.
Molecular Properties
| Compound Name | imino-[(Z)-3-oxo-1,3-diphenylprop-1-en-2-yl]iminoazanium |
| PubChem CID | 6333032 |
| Molecular Formula | C15H12N3O+ |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | imino-[(Z)-3-oxo-1,3-diphenylprop-1-en-2-yl]iminoazanium |
| SMILES | N=[N+]=N/C(=C\c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H12N3O/c16-18-17-14(11-12-7-3-1-4-8-12)15(19)13-9-5-2-6-10-13/h1-11,16H/q+1/b14-11- |
| InChIKey | QZPAJNRWKJFWLZ-KAMYIIQDSA-N |
| XLogP | 3.46 |
| TPSA | 67.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze imino-[(Z)-3-oxo-1,3-diphenylprop-1-en-2-yl]iminoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imino-[(Z)-3-oxo-1,3-diphenylprop-1-en-2-yl]iminoazanium?
The IUPAC name of imino-[(Z)-3-oxo-1,3-diphenylprop-1-en-2-yl]iminoazanium (CID 6333032) is imino-[(Z)-3-oxo-1,3-diphenylprop-1-en-2-yl]iminoazanium.
What is the SMILES notation for imino-[(Z)-3-oxo-1,3-diphenylprop-1-en-2-yl]iminoazanium?
The canonical SMILES for imino-[(Z)-3-oxo-1,3-diphenylprop-1-en-2-yl]iminoazanium is N=[N+]=N/C(=C\c1ccccc1)C(=O)c1ccccc1.
What is the InChIKey of imino-[(Z)-3-oxo-1,3-diphenylprop-1-en-2-yl]iminoazanium?
The InChIKey is QZPAJNRWKJFWLZ-KAMYIIQDSA-N. The full InChI is InChI=1S/C15H12N3O/c16-18-17-14(11-12-7-3-1-4-8-12)15(19)13-9-5-2-6-10-13/h1-11,16H/q+1/b14-11-.
What are the key properties of imino-[(Z)-3-oxo-1,3-diphenylprop-1-en-2-yl]iminoazanium?
imino-[(Z)-3-oxo-1,3-diphenylprop-1-en-2-yl]iminoazanium has a molecular weight of 250.28 g/mol, XLogP of 3.46, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for imino-[(Z)-3-oxo-1,3-diphenylprop-1-en-2-yl]iminoazanium is sourced from PubChem (CID 6333032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).