C12H21N3O4S2 — CID 63341165
2-[4-(1,1-dioxothian-4-yl)sulfonylpiperazin-1-yl]propanenitrile (PubChem CID 63341165) has the molecular formula C12H21N3O4S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-[4-(1,1-dioxothian-4-yl)sulfonylpiperazin-1-yl]propanenitrile.
| Compound Name | 2-[4-(1,1-dioxothian-4-yl)sulfonylpiperazin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 63341165 |
| Molecular Formula | C12H21N3O4S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 2-[4-(1,1-dioxothian-4-yl)sulfonylpiperazin-1-yl]propanenitrile |
| SMILES | CC(C#N)N1CCN(S(=O)(=O)C2CCS(=O)(=O)CC2)CC1 |
| InChI | InChI=1S/C12H21N3O4S2/c1-11(10-13)14-4-6-15(7-5-14)21(18,19)12-2-8-20(16,17)9-3-12/h11-12H,2-9H2,1H3 |
| InChIKey | ZTXARZXRJMEXRL-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 98.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |