C5H7N2OSe — CID 6335031
5,5-Dimethyl-2-selenoxoimidazolidin-4-one (PubChem CID 6335031) has the molecular formula C5H7N2OSe and a molecular weight of 190.08 g/mol.
| Compound Name | 5,5-Dimethyl-2-selenoxoimidazolidin-4-one |
|---|---|
| PubChem CID | 6335031 |
| Molecular Formula | C5H7N2OSe |
| Molecular Weight | 190.08 g/mol |
| Exact Mass | 190.97 |
| IUPAC Name | — |
| SMILES | CC1(C)N=C([Se])NC1=O |
| InChI | InChI=1S/C5H7N2OSe/c1-5(2)3(8)6-4(9)7-5/h1-2H3,(H,6,7,8) |
| InChIKey | WKYKGHPNWKKWBP-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.08 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|