C15H22N6O5+2 — CID 6335940
(E)-6-[[(E)-1-carboxy-5-diazonio-4-hydroxypent-4-enyl]amino]-2-hydroxy-6-oxo-5-(prop-2-enylamino)hex-1-ene-1-diazonium (PubChem CID 6335940) has the molecular formula C15H22N6O5+2 and a molecular weight of 366.38 g/mol. Its IUPAC name is (E)-6-[[(E)-1-carboxy-5-diazonio-4-hydroxypent-4-enyl]amino]-2-hydroxy-6-oxo-5-(prop-2-enylamino)hex-1-ene-1-diazonium.
| Compound Name | (E)-6-[[(E)-1-carboxy-5-diazonio-4-hydroxypent-4-enyl]amino]-2-hydroxy-6-oxo-5-(prop-2-enylamino)hex-1-ene-1-diazonium |
|---|---|
| PubChem CID | 6335940 |
| Molecular Formula | C15H22N6O5+2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | (E)-6-[[(E)-1-carboxy-5-diazonio-4-hydroxypent-4-enyl]amino]-2-hydroxy-6-oxo-5-(prop-2-enylamino)hex-1-ene-1-diazonium |
| SMILES | C=CCNC(CC/C(O)=C\[N+]#N)C(=O)NC(CC/C(O)=C\[N+]#N)C(=O)O |
| InChI | InChI=1S/C15H20N6O5/c1-2-7-18-12(5-3-10(22)8-19-16)14(24)21-13(15(25)26)6-4-11(23)9-20-17/h2,8-9,12-13,18H,1,3-7H2,(H2-2,21,22,23,24,25,26)/p+2/b10-8+,11-9+ |
| InChIKey | RCQIFJCPIWRTAF-GFULKKFKSA-P |
| XLogP | 1.77 |
| TPSA | 175.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|