C13H26ClN3O2S — CID 63397037
1-(2-chloroethyl)-4-(4-methylpiperidin-1-yl)sulfonyl-1,4-diazepane (PubChem CID 63397037) has the molecular formula C13H26ClN3O2S and a molecular weight of 323.89 g/mol. Its IUPAC name is 1-(2-chloroethyl)-4-(4-methylpiperidin-1-yl)sulfonyl-1,4-diazepane.
| Compound Name | 1-(2-chloroethyl)-4-(4-methylpiperidin-1-yl)sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 63397037 |
| Molecular Formula | C13H26ClN3O2S |
| Molecular Weight | 323.89 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 1-(2-chloroethyl)-4-(4-methylpiperidin-1-yl)sulfonyl-1,4-diazepane |
| SMILES | CC1CCN(S(=O)(=O)N2CCCN(CCCl)CC2)CC1 |
| InChI | InChI=1S/C13H26ClN3O2S/c1-13-3-8-17(9-4-13)20(18,19)16-7-2-6-15(10-5-14)11-12-16/h13H,2-12H2,1H3 |
| InChIKey | LHBDWHLXOQEJMT-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.89 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|